![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 02 Quake Theme.mp3 | 2025-11-29 02:35 | 12M | |
| 03 Aftermath.mp3 | 2025-11-29 02:35 | 5.6M | |
| 04 The Hall of Souls.mp3 | 2025-11-29 02:35 | 19M | |
| 05 It is Raped.mp3 | 2025-11-29 02:35 | 14M | |
| 06 Parallel Dimensions.mp3 | 2025-11-29 02:35 | 17M | |
| 07 Life.mp3 | 2025-11-29 02:35 | 20M | |
| 08 Damnation.mp3 | 2025-11-29 02:35 | 13M | |
| 09 Focus.mp3 | 2025-11-29 02:35 | 15M | |
| 10 Falling.mp3 | 2025-11-29 02:35 | 8.1M | |
| 11 The Reaction.mp3 | 2025-11-29 02:35 | 12M | |